CAS 1346691-75-5
:Methyl 5-(3,5-difluorophenyl)-3-pyridinecarboxylate
Description:
Methyl 5-(3,5-difluorophenyl)-3-pyridinecarboxylate is an organic compound characterized by its pyridine and aromatic fluorinated substituents. It features a pyridine ring, which is a six-membered heterocyclic structure containing one nitrogen atom, and a carboxylate functional group, indicating its potential as an ester. The presence of the 3,5-difluorophenyl group suggests that the compound has significant electron-withdrawing properties due to the fluorine atoms, which can influence its reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure contributes to its solubility and stability in various solvents, which is essential for applications in synthesis and formulation. Additionally, the presence of fluorine can enhance lipophilicity, potentially affecting the compound's bioavailability and metabolic pathways. Overall, Methyl 5-(3,5-difluorophenyl)-3-pyridinecarboxylate is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C13H9F2NO2
InChI:InChI=1S/C13H9F2NO2/c1-18-13(17)10-2-9(6-16-7-10)8-3-11(14)5-12(15)4-8/h2-7H,1H3
InChI key:InChIKey=MGYRDKIIONLNTJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CN=C1)C2=CC(F)=CC(F)=C2
Synonyms:- Methyl 5-(3,5-difluorophenyl)-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 5-(3,5-difluorophenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
