CymitQuimica logo

CAS 1346691-88-0

:

5-(4-Chloro-2-fluorophenyl)-3-pyridinecarboxamide

Description:
5-(4-Chloro-2-fluorophenyl)-3-pyridinecarboxamide is a chemical compound characterized by its specific molecular structure, which includes a pyridine ring and a carboxamide functional group. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is typically classified as an aromatic amide, which may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its molecular interactions can be influenced by the electronegative halogen atoms, potentially affecting its pharmacological profile if studied in a biological context. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. As with many chemical substances, safety data and handling precautions should be considered, especially regarding its potential toxicity and environmental impact.
Formula:C12H8ClFN2O
InChI:InChI=1S/C12H8ClFN2O/c13-9-1-2-10(11(14)4-9)7-3-8(12(15)17)6-16-5-7/h1-6H,(H2,15,17)
InChI key:InChIKey=OHZLEVYIGIFMDW-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C(N)=O)C=NC2)C=CC(Cl)=C1
Synonyms:
  • 3-Pyridinecarboxamide, 5-(4-chloro-2-fluorophenyl)-
  • 5-(4-Chloro-2-fluorophenyl)-3-pyridinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.