CAS 1346691-90-4
:5-(4-Chloro-2-fluorophenyl)-3-pyridinemethanol
Description:
5-(4-Chloro-2-fluorophenyl)-3-pyridinemethanol is a chemical compound characterized by its unique structure, which includes a pyridine ring and a phenyl group substituted with chlorine and fluorine atoms. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The hydroxymethyl group (-CH2OH) attached to the pyridine ring suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with biological targets. The presence of halogen substituents, specifically chlorine and fluorine, can enhance lipophilicity and affect the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific biological activities, which could be explored in drug development or as a research tool. Overall, its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals, although specific biological or chemical activities would require further investigation.
Formula:C12H9ClFNO
InChI:InChI=1S/C12H9ClFNO/c13-10-1-2-11(12(14)4-10)9-3-8(7-16)5-15-6-9/h1-6,16H,7H2
InChI key:InChIKey=CDSDEHUJJVGIAP-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(Cl)=C1)C=2C=C(CO)C=NC2
Synonyms:- 5-(4-Chloro-2-fluorophenyl)-3-pyridinemethanol
- 3-Pyridinemethanol, 5-(4-chloro-2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
