CAS 1346691-96-0
:5-(4-Chloro-3-fluorophenyl)-3-pyridinecarboxaldehyde
Description:
5-(4-Chloro-3-fluorophenyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its complex structure, which includes a pyridine ring and an aldehyde functional group. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate to high polarity due to the electronegative halogen atoms, which can influence its solubility in various solvents. The aldehyde group is reactive, making it a potential candidate for further chemical modifications, such as condensation reactions or as an intermediate in the synthesis of more complex molecules. Additionally, the compound may exhibit interesting biological activities, which can be explored in drug discovery contexts. Its molecular structure suggests potential interactions with biological targets, making it a subject of interest in pharmaceutical research. Overall, 5-(4-Chloro-3-fluorophenyl)-3-pyridinecarboxaldehyde is a versatile compound with significant implications in various fields of chemistry.
Formula:C12H7ClFNO
InChI:InChI=1S/C12H7ClFNO/c13-11-2-1-9(4-12(11)14)10-3-8(7-16)5-15-6-10/h1-7H
InChI key:InChIKey=ONLQVOQKCCBLIM-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1Cl)C=2C=C(C=O)C=NC2
Synonyms:- 3-Pyridinecarboxaldehyde, 5-(4-chloro-3-fluorophenyl)-
- 5-(4-Chloro-3-fluorophenyl)-3-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
