
CAS 1346692-06-5
:5-(3-Chloro-2-fluorophenyl)-3-pyridinemethanol
Description:
5-(3-Chloro-2-fluorophenyl)-3-pyridinemethanol is a chemical compound characterized by its unique structural features, which include a pyridine ring and a phenyl group substituted with chlorine and fluorine atoms. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the hydroxymethyl group (-CH2OH) suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The chlorine and fluorine substituents can significantly affect the compound's electronic properties, potentially enhancing its lipophilicity and altering its pharmacokinetic profile. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and interactions with biological targets. Overall, 5-(3-Chloro-2-fluorophenyl)-3-pyridinemethanol represents a complex molecule with potential utility in various chemical and biological contexts.
Formula:C12H9ClFNO
InChI:InChI=1S/C12H9ClFNO/c13-11-3-1-2-10(12(11)14)9-4-8(7-16)5-15-6-9/h1-6,16H,7H2
InChI key:InChIKey=VEVOUCFFCGUFJI-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1Cl)C=2C=C(CO)C=NC2
Synonyms:- 5-(3-Chloro-2-fluorophenyl)-3-pyridinemethanol
- 3-Pyridinemethanol, 5-(3-chloro-2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
