CymitQuimica logo

CAS 1346692-09-8

:

5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxylic acid

Description:
5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique chemical properties, potentially influencing its reactivity and interaction with biological systems. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the halogen substituents may enhance lipophilicity. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. The compound may also serve as an intermediate in organic synthesis or as a building block for more complex molecules. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact. Overall, 5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxylic acid represents a valuable compound in the field of medicinal chemistry and materials science.
Formula:C12H7ClFNO2
InChI:InChI=1S/C12H7ClFNO2/c13-9-1-2-11(14)10(4-9)7-3-8(12(16)17)6-15-5-7/h1-6H,(H,16,17)
InChI key:InChIKey=GZJJTQMGLCWFQM-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C(O)=O)C=NC2)C=C(Cl)C=C1
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-(5-chloro-2-fluorophenyl)-
  • 5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.