CAS 1346692-11-2
:5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxamide
Description:
5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxamide is a chemical compound characterized by its specific molecular structure, which includes a pyridine ring and a carboxamide functional group. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular formula indicates a certain degree of polarity, which can influence its interactions in biological systems. The compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to the presence of the pyridine and amide functionalities, which are often associated with bioactive compounds. Additionally, the halogen substituents can enhance the compound's lipophilicity and metabolic stability. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C12H8ClFN2O
InChI:InChI=1S/C12H8ClFN2O/c13-9-1-2-11(14)10(4-9)7-3-8(12(15)17)6-16-5-7/h1-6H,(H2,15,17)
InChI key:InChIKey=OYGWELQVRYJPJF-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C(N)=O)C=NC2)C=C(Cl)C=C1
Synonyms:- 5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 5-(5-chloro-2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
