CAS 1346692-12-3
:5-(5-Chloro-2-fluorophenyl)-3-pyridinecarbonitrile
Description:
5-(5-Chloro-2-fluorophenyl)-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring and a cyano group. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in pharmaceutical research. The cyano group can participate in various chemical reactions, enhancing its utility in synthetic pathways. Additionally, the presence of halogen atoms can influence the compound's electronic properties, potentially affecting its biological activity. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose specific health and environmental risks. Overall, 5-(5-Chloro-2-fluorophenyl)-3-pyridinecarbonitrile represents a valuable compound for further exploration in chemical and biological research.
Formula:C12H6ClFN2
InChI:InChI=1S/C12H6ClFN2/c13-10-1-2-12(14)11(4-10)9-3-8(5-15)6-16-7-9/h1-4,6-7H
InChI key:InChIKey=OXANZZRRLVAWBX-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C#N)C=NC2)C=C(Cl)C=C1
Synonyms:- 3-Pyridinecarbonitrile, 5-(5-chloro-2-fluorophenyl)-
- 5-(5-Chloro-2-fluorophenyl)-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
