
CAS 1346692-13-4
:5-(5-Chloro-2-fluorophenyl)-3-pyridinemethanol
Description:
5-(5-Chloro-2-fluorophenyl)-3-pyridinemethanol is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring and a phenyl group substituted with chlorine and fluorine atoms. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The hydroxymethyl group (-CH2OH) attached to the pyridine ring contributes to its solubility in polar solvents and may influence its biological activity. The presence of halogen substituents, specifically chlorine and fluorine, can enhance lipophilicity and alter the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific optical properties due to the arrangement of its substituents, which can be relevant in applications such as drug design or material science. Overall, 5-(5-Chloro-2-fluorophenyl)-3-pyridinemethanol represents a versatile structure with potential applications in various chemical and pharmaceutical fields.
Formula:C12H9ClFNO
InChI:InChI=1S/C12H9ClFNO/c13-10-1-2-12(14)11(4-10)9-3-8(7-16)5-15-6-9/h1-6,16H,7H2
InChI key:InChIKey=HBDSQLMRDMHMAQ-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(CO)C=NC2)C=C(Cl)C=C1
Synonyms:- 3-Pyridinemethanol, 5-(5-chloro-2-fluorophenyl)-
- 5-(5-Chloro-2-fluorophenyl)-3-pyridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
