CAS 1346692-14-5
:5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxaldehyde
Description:
5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its complex structure, which includes a pyridine ring and an aldehyde functional group. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate to high polarity due to the electronegative halogen atoms, which can influence its solubility in various solvents. The aldehyde group is reactive, making it a potential candidate for further chemical transformations, such as condensation reactions or as an intermediate in the synthesis of more complex molecules. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and specific conditions under which it is studied. Overall, 5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxaldehyde represents a valuable structure in the field of organic synthesis and drug development.
Formula:C12H7ClFNO
InChI:InChI=1S/C12H7ClFNO/c13-10-1-2-12(14)11(4-10)9-3-8(7-16)5-15-6-9/h1-7H
InChI key:InChIKey=PCCMNNVEMKZVEW-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C=O)C=NC2)C=C(Cl)C=C1
Synonyms:- 3-Pyridinecarboxaldehyde, 5-(5-chloro-2-fluorophenyl)-
- 5-(5-Chloro-2-fluorophenyl)-3-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
