
CAS 1346692-15-6
:5-(5-Chloro-2-fluorophenyl)-3-pyridinemethanamine
Description:
5-(5-Chloro-2-fluorophenyl)-3-pyridinemethanamine is a chemical compound characterized by its specific molecular structure, which includes a pyridine ring and a substituted phenyl group. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is typically classified as an amine due to the presence of an amine functional group (-NH2), which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit interesting pharmacological properties. The compound's solubility, stability, and reactivity can be influenced by the electronic effects of the halogen substituents, making it a subject of interest in both synthetic and medicinal chemistry research. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups, which may pose specific health and environmental risks.
Formula:C12H10ClFN2
InChI:InChI=1S/C12H10ClFN2/c13-10-1-2-12(14)11(4-10)9-3-8(5-15)6-16-7-9/h1-4,6-7H,5,15H2
InChI key:InChIKey=SZGHBNPDDGTGJY-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(CN)C=NC2)C=C(Cl)C=C1
Synonyms:- 5-(5-Chloro-2-fluorophenyl)-3-pyridinemethanamine
- 3-Pyridinemethanamine, 5-(5-chloro-2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(5-(5-Chloro-2-fluorophenyl)pyridin-3-yl)methanamine
CAS:Formula:C12H10ClFN2Molecular weight:236.6726
