CymitQuimica logo

CAS 1346692-17-8

:

5-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxamide

Description:
5-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxamide is a chemical compound characterized by its unique structural features, which include a pyridine ring and a carboxamide functional group. The presence of a chloro and a fluorine substituent on the phenyl ring contributes to its potential biological activity and lipophilicity. This compound is typically classified as an aromatic amide, which may exhibit various properties such as solubility in organic solvents and moderate stability under standard conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound's specific reactivity and interactions would depend on its functional groups and the overall electronic distribution within the molecule. Additionally, the presence of halogens can influence its pharmacokinetic properties, such as absorption and metabolism. Overall, 5-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxamide represents a class of compounds that may have applications in pharmaceuticals, particularly in the development of therapeutic agents.
Formula:C12H8ClFN2O
InChI:InChI=1S/C12H8ClFN2O/c13-10-2-7(3-11(14)4-10)8-1-9(12(15)17)6-16-5-8/h1-6H,(H2,15,17)
InChI key:InChIKey=LQKWOJMCVNEYDB-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(F)C1)C=2C=C(C(N)=O)C=NC2
Synonyms:
  • 3-Pyridinecarboxamide, 5-(3-chloro-5-fluorophenyl)-
  • 5-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.