
CAS 1346692-18-9
:5-(3-Chloro-5-fluorophenyl)-3-pyridinecarbonitrile
Description:
5-(3-Chloro-5-fluorophenyl)-3-pyridinecarbonitrile is a chemical compound characterized by its unique structural features, which include a pyridine ring and a cyano group attached to a phenyl ring that contains both chlorine and fluorine substituents. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate to high polarity due to the presence of the cyano group and halogen atoms. The chlorine and fluorine substituents can influence its reactivity and solubility, often enhancing its biological activity and potential as a pharmaceutical intermediate. The presence of the cyano group suggests potential applications in organic synthesis and medicinal chemistry, as it can serve as a versatile functional group for further chemical modifications. Additionally, the compound's molecular structure may confer specific interactions with biological targets, making it of interest in drug discovery and development. Overall, 5-(3-Chloro-5-fluorophenyl)-3-pyridinecarbonitrile represents a valuable compound in the field of organic and medicinal chemistry.
Formula:C12H6ClFN2
InChI:InChI=1S/C12H6ClFN2/c13-11-2-9(3-12(14)4-11)10-1-8(5-15)6-16-7-10/h1-4,6-7H
InChI key:InChIKey=AUPNXSGOVIRDAY-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C2=CC(Cl)=CC(F)=C2
Synonyms:- 5-(3-Chloro-5-fluorophenyl)-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 5-(3-chloro-5-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
