
CAS 1346692-19-0
:5-(3-Chloro-5-fluorophenyl)-3-pyridinemethanol
Description:
5-(3-Chloro-5-fluorophenyl)-3-pyridinemethanol is a chemical compound characterized by its unique structural features, which include a pyridine ring and a phenyl group substituted with chlorine and fluorine atoms. The presence of the hydroxymethyl group (-CH2OH) attached to the pyridine ring contributes to its potential as a pharmacophore in medicinal chemistry. This compound may exhibit various biological activities due to its ability to interact with specific biological targets, making it of interest in drug development. Its molecular structure suggests potential for hydrogen bonding and lipophilicity, which can influence its solubility and permeability. The chlorine and fluorine substituents can also affect the compound's electronic properties and reactivity. As with many organic compounds, its stability, reactivity, and interactions with other substances will depend on environmental conditions such as pH and temperature. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C12H9ClFNO
InChI:InChI=1S/C12H9ClFNO/c13-11-2-9(3-12(14)4-11)10-1-8(7-16)5-15-6-10/h1-6,16H,7H2
InChI key:InChIKey=FHNWBSGJQXSWQR-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1)C2=CC(Cl)=CC(F)=C2
Synonyms:- 3-Pyridinemethanol, 5-(3-chloro-5-fluorophenyl)-
- 5-(3-Chloro-5-fluorophenyl)-3-pyridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
