CAS 1346692-20-3
:5-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxaldehyde
Description:
5-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its complex structure, which includes a pyridine ring and an aldehyde functional group. The presence of a chloro and a fluorine substituent on the phenyl ring contributes to its unique reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery and development. The aldehyde group can participate in various chemical reactions, including condensation and reduction, which further enhances its utility in synthetic organic chemistry. Additionally, the compound's specific functional groups may influence its electronic properties, making it a candidate for studies in materials science or as a precursor in the synthesis of more complex molecules. Overall, 5-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxaldehyde represents a versatile building block in organic synthesis and pharmaceutical research.
Formula:C12H7ClFNO
InChI:InChI=1S/C12H7ClFNO/c13-11-2-9(3-12(14)4-11)10-1-8(7-16)5-15-6-10/h1-7H
InChI key:InChIKey=PKAAIPZFMVCGPG-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=CN=C1)C2=CC(Cl)=CC(F)=C2
Synonyms:- 5-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxaldehyde
- 3-Pyridinecarboxaldehyde, 5-(3-chloro-5-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
