CAS 1346692-21-4

5-(3-Chloro-5-fluorophenyl)-3-pyridinemethanamine

Description:

5-(3-Chloro-5-fluorophenyl)-3-pyridinemethanamine, identified by its CAS number 1346692-21-4, is a chemical compound that features a pyridine ring substituted with an amine group and a phenyl group that contains both chlorine and fluorine substituents. This compound is characterized by its potential biological activity, which may include interactions with specific receptors or enzymes, making it of interest in pharmaceutical research. The presence of halogen atoms, such as chlorine and fluorine, often enhances the lipophilicity and metabolic stability of organic molecules, which can influence their pharmacokinetic properties. Additionally, the structural arrangement suggests that it may exhibit unique electronic properties due to the electron-withdrawing effects of the halogens. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound's specific characteristics and potential applications would require further investigation through experimental studies and computational modeling.

Formula: C₁₂H₁₀ClFN₂

InChI: InChI=1S/C12H10ClFN2/c13-11-2-9(3-12(14)4-11)10-1-8(5-15)6-16-7-10/h1-4,6-7H,5,15H2

InChI key: InChIKey=OPAPSLGSJNZJKQ-UHFFFAOYSA-N

SMILES: C(N)C1=CC(=CN=C1)C2=CC(Cl)=CC(F)=C2

Synonyms:

• 5-(3-Chloro-5-fluorophenyl)-3-pyridinemethanamine
• 3-Pyridinemethanamine, 5-(3-chloro-5-fluorophenyl)-

(5-(3-Chloro-5-fluorophenyl)pyridin-3-yl)methanamine

CAS: 1346692-21-4

Formula: C₁₂H₁₀ClFN₂

Molecular weight: 236.6726

Ref: IN-DA00HTL2