CAS 1346692-23-6
:5-(2,5-Difluorophenyl)-3-pyridinecarboxamide
Description:
5-(2,5-Difluorophenyl)-3-pyridinecarboxamide is a chemical compound characterized by its unique structure, which includes a pyridine ring and a carboxamide functional group. The presence of the difluorophenyl moiety contributes to its potential biological activity and lipophilicity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific formulation and purity. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The difluorophenyl group can enhance the compound's metabolic stability and selectivity. Additionally, the presence of the carboxamide group may facilitate hydrogen bonding, influencing its pharmacokinetic properties. Overall, 5-(2,5-Difluorophenyl)-3-pyridinecarboxamide is a compound that may have applications in pharmaceutical research, particularly in the development of new therapeutic agents.
Formula:C12H8F2N2O
InChI:InChI=1S/C12H8F2N2O/c13-9-1-2-11(14)10(4-9)7-3-8(12(15)17)6-16-5-7/h1-6H,(H2,15,17)
InChI key:InChIKey=VVYZZQKUUNTAJG-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C(N)=O)C=NC2)C=C(F)C=C1
Synonyms:- 3-Pyridinecarboxamide, 5-(2,5-difluorophenyl)-
- 5-(2,5-Difluorophenyl)-3-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
