CymitQuimica logo

CAS 1346692-24-7

:

5-(2,5-Difluorophenyl)-3-pyridinecarbonitrile

Description:
5-(2,5-Difluorophenyl)-3-pyridinecarbonitrile is an organic compound characterized by its unique structure, which includes a pyridine ring and a cyano group. The presence of the difluorophenyl substituent contributes to its chemical properties, including potential reactivity and solubility characteristics. This compound is likely to exhibit polar characteristics due to the cyano group, which can influence its interactions in various chemical environments. The difluorophenyl moiety may enhance its lipophilicity, affecting its biological activity and potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Its specific applications would depend on its biological activity, which could be explored through further research. Overall, 5-(2,5-Difluorophenyl)-3-pyridinecarbonitrile represents a compound of interest in organic synthesis and medicinal chemistry due to its distinctive functional groups and potential utility in various chemical contexts.
Formula:C12H6F2N2
InChI:InChI=1S/C12H6F2N2/c13-10-1-2-12(14)11(4-10)9-3-8(5-15)6-16-7-9/h1-4,6-7H
InChI key:InChIKey=XWWRGWSPBNWUIN-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C#N)C=NC2)C=C(F)C=C1
Synonyms:
  • 3-Pyridinecarbonitrile, 5-(2,5-difluorophenyl)-
  • 5-(2,5-Difluorophenyl)-3-pyridinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.