CymitQuimica logo

CAS 1346692-25-8

:

5-(2,5-Difluorophenyl)-3-pyridinemethanamine

Description:
5-(2,5-Difluorophenyl)-3-pyridinemethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a difluorophenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of fluorine atoms in the difluorophenyl moiety can influence its reactivity and lipophilicity, potentially enhancing its biological activity. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's solubility and stability can be affected by the functional groups present, making it important to consider these factors in practical applications. Overall, 5-(2,5-Difluorophenyl)-3-pyridinemethanamine represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C12H10F2N2
InChI:InChI=1S/C12H10F2N2/c13-10-1-2-12(14)11(4-10)9-3-8(5-15)6-16-7-9/h1-4,6-7H,5,15H2
InChI key:InChIKey=MFEGFGGTBNYJMQ-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(CN)C=NC2)C=C(F)C=C1
Synonyms:
  • 5-(2,5-Difluorophenyl)-3-pyridinemethanamine
  • 3-Pyridinemethanamine, 5-(2,5-difluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.