CymitQuimica logo

CAS 1346692-27-0

:

Methyl 5-(2-chloro-5-fluorophenyl)-3-pyridinecarboxylate

Description:
Methyl 5-(2-chloro-5-fluorophenyl)-3-pyridinecarboxylate is a chemical compound characterized by its complex structure, which includes a pyridine ring and a substituted phenyl group. The presence of a methyl ester functional group contributes to its reactivity and solubility properties. The compound features a chlorine atom and a fluorine atom on the phenyl ring, which can influence its electronic properties and potential biological activity. Typically, such halogenated compounds may exhibit unique interactions in biological systems, making them of interest in pharmaceutical research. The pyridine moiety often contributes to the compound's ability to participate in hydrogen bonding and coordination with metal ions. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of targeted therapies or as intermediates in organic synthesis. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be considered due to the presence of halogens, which can pose health risks.
Formula:C13H9ClFNO2
InChI:InChI=1S/C13H9ClFNO2/c1-18-13(17)9-4-8(6-16-7-9)11-5-10(15)2-3-12(11)14/h2-7H,1H3
InChI key:InChIKey=VFISGNIEOSQIKT-UHFFFAOYSA-N
SMILES:ClC1=C(C=2C=C(C(OC)=O)C=NC2)C=C(F)C=C1
Synonyms:
  • Methyl 5-(2-chloro-5-fluorophenyl)-3-pyridinecarboxylate
  • 3-Pyridinecarboxylic acid, 5-(2-chloro-5-fluorophenyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.