CAS 1346692-28-1
:5-(2-Chloro-5-fluorophenyl)-3-pyridinecarboxamide
Description:
5-(2-Chloro-5-fluorophenyl)-3-pyridinecarboxamide is a chemical compound characterized by its specific functional groups and structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, and a carboxamide group, indicating the presence of an amine bonded to a carbonyl. The compound also features a chlorinated and fluorinated phenyl group, which can influence its reactivity and biological activity. The presence of halogens, such as chlorine and fluorine, often enhances the lipophilicity and metabolic stability of the compound, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of targeted therapies. The compound's unique characteristics may also contribute to its interactions with biological targets, making it a candidate for further investigation in drug discovery processes. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H8ClFN2O
InChI:InChI=1S/C12H8ClFN2O/c13-11-2-1-9(14)4-10(11)7-3-8(12(15)17)6-16-5-7/h1-6H,(H2,15,17)
InChI key:InChIKey=HEFAPOFDKLCWND-UHFFFAOYSA-N
SMILES:ClC1=C(C=2C=C(C(N)=O)C=NC2)C=C(F)C=C1
Synonyms:- 3-Pyridinecarboxamide, 5-(2-chloro-5-fluorophenyl)-
- 5-(2-Chloro-5-fluorophenyl)-3-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
