
CAS 1346692-29-2
:5-(2-Chloro-5-fluorophenyl)-3-pyridinecarbonitrile
Description:
5-(2-Chloro-5-fluorophenyl)-3-pyridinecarbonitrile is a chemical compound characterized by its unique structural features, which include a pyridine ring and a cyano group attached to a phenyl ring that contains both chlorine and fluorine substituents. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate to high polarity due to the presence of the cyano group and halogen atoms. The chlorine and fluorine substituents can influence its reactivity and solubility, often enhancing its biological activity and making it a subject of interest in medicinal chemistry. The presence of the cyano group may also contribute to its potential as a building block in organic synthesis. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, this compound's unique functional groups and structural arrangement make it relevant in various chemical and pharmaceutical applications.
Formula:C12H6ClFN2
InChI:InChI=1S/C12H6ClFN2/c13-12-2-1-10(14)4-11(12)9-3-8(5-15)6-16-7-9/h1-4,6-7H
InChI key:InChIKey=GSMFAXQPOWBABM-UHFFFAOYSA-N
SMILES:ClC1=C(C=2C=C(C#N)C=NC2)C=C(F)C=C1
Synonyms:- 5-(2-Chloro-5-fluorophenyl)-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 5-(2-chloro-5-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
