
CAS 1346692-31-6
:5-(2-Chloro-5-fluorophenyl)-3-pyridinecarboxaldehyde
Description:
5-(2-Chloro-5-fluorophenyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its complex structure, which includes a pyridine ring and an aldehyde functional group. The presence of a chloro and a fluorine substituent on the phenyl ring contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential for interactions in biological systems, making it of interest in drug development and synthesis. The aldehyde group can participate in various chemical reactions, such as condensation and reduction, which are valuable in organic synthesis. Additionally, the presence of halogen atoms can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity. Overall, 5-(2-Chloro-5-fluorophenyl)-3-pyridinecarboxaldehyde is a compound of interest for further research in the fields of organic chemistry and pharmacology.
Formula:C12H7ClFNO
InChI:InChI=1S/C12H7ClFNO/c13-12-2-1-10(14)4-11(12)9-3-8(7-16)5-15-6-9/h1-7H
InChI key:InChIKey=NWXJJTGTZGULGY-UHFFFAOYSA-N
SMILES:ClC1=C(C=2C=C(C=O)C=NC2)C=C(F)C=C1
Synonyms:- 3-Pyridinecarboxaldehyde, 5-(2-chloro-5-fluorophenyl)-
- 5-(2-Chloro-5-fluorophenyl)-3-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
