
CAS 1346697-27-5
:1,1-Dimethylethyl N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethyl]carbamate
Description:
1,1-Dimethylethyl N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethyl]carbamate, identified by its CAS number 1346697-27-5, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a boron-containing moiety. This compound features a pyridine ring, which contributes to its potential biological activity, and a dioxaborolane group that may enhance its stability and reactivity. The presence of the tert-butyl group (1,1-dimethylethyl) suggests that the compound may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. Its unique structure may allow for specific interactions with target proteins or enzymes, making it of interest in medicinal chemistry and agricultural applications. Additionally, the compound's synthesis and stability under various conditions can be critical for its practical use, particularly in formulations where efficacy and shelf-life are important. Overall, this compound exemplifies the intricate design often found in modern chemical research aimed at developing novel therapeutic agents or agrochemicals.
Formula:C18H29BN2O5
InChI:InChI=1S/C18H29BN2O5/c1-16(2,3)24-15(22)21-10-11-23-14-12-13(8-9-20-14)19-25-17(4,5)18(6,7)26-19/h8-9,12H,10-11H2,1-7H3,(H,21,22)
InChI key:InChIKey=WJYZQKXJQZLJMQ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCCNC(OC(C)(C)C)=O)N=CC2
Synonyms:- 1,1-Dimethylethyl N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethyl]carbamate
- Carbamic acid, N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Carbamic acid, N-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethyl]-, 1,1-dimethylethyl ester
CAS:Formula:C18H29BN2O5Molecular weight:364.2443
