CymitQuimica logo

CAS 1346697-42-4

:

5-Bromo-4-(cyclopentylmethyl)pyrimidine

Description:
5-Bromo-4-(cyclopentylmethyl)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom and a cyclopentylmethyl group. The presence of the bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its physical properties, such as solubility and boiling point. The cyclopentylmethyl substituent contributes to the compound's steric bulk and can affect its interaction with biological targets, making it of interest in medicinal chemistry. This compound may exhibit various biological activities, potentially serving as a scaffold for drug development. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and the cyclopentylmethyl group. Overall, 5-Bromo-4-(cyclopentylmethyl)pyrimidine is a compound of interest in both synthetic and medicinal chemistry due to its unique structural features.
Formula:C10H13BrN2
InChI:InChI=1S/C10H13BrN2/c11-9-6-12-7-13-10(9)5-8-3-1-2-4-8/h6-8H,1-5H2
InChI key:InChIKey=LDMWNKWKICDHFX-UHFFFAOYSA-N
SMILES:C(C=1C(Br)=CN=CN1)C2CCCC2
Synonyms:
  • Pyrimidine, 5-bromo-4-(cyclopentylmethyl)-
  • 5-Bromo-4-(cyclopentylmethyl)pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.