
CAS 1346697-43-5
:5-Bromo-4-(cyclohexylmethyl)pyrimidine
Description:
5-Bromo-4-(cyclohexylmethyl)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom and a cyclohexylmethyl group. The presence of the bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its physical properties, such as solubility and boiling point. The cyclohexylmethyl group contributes to the compound's hydrophobic characteristics, potentially affecting its interactions in biological systems and its overall lipophilicity. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its structure suggests potential applications in the development of pharmaceuticals, particularly in targeting specific biological pathways. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including nucleophilic substitution and purification methods. Overall, 5-Bromo-4-(cyclohexylmethyl)pyrimidine represents a versatile scaffold for further chemical modifications and investigations in various fields, including drug discovery and materials science.
Formula:C11H15BrN2
InChI:InChI=1S/C11H15BrN2/c12-10-7-13-8-14-11(10)6-9-4-2-1-3-5-9/h7-9H,1-6H2
InChI key:InChIKey=NUMJSSHVAQUQJR-UHFFFAOYSA-N
SMILES:C(C=1C(Br)=CN=CN1)C2CCCCC2
Synonyms:- Pyrimidine, 5-bromo-4-(cyclohexylmethyl)-
- 5-Bromo-4-(cyclohexylmethyl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
