CymitQuimica logo

CAS 1346697-46-8

:

4-Chloro-5-(2-methylpropoxy)-3(2H)-pyridazinone

Description:
4-Chloro-5-(2-methylpropoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core structure, which features a chloro substituent and a branched alkoxy group. The presence of the chloro group typically imparts certain reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The 2-methylpropoxy group enhances the compound's lipophilicity, which can influence its solubility and bioavailability in biological systems. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of new therapeutic agents. The compound's stability, reactivity, and interactions with biological targets would depend on its specific functional groups and overall molecular conformation. As with any chemical substance, safety data and handling precautions should be considered, especially regarding its potential toxicity and environmental impact.
Formula:C8H11ClN2O2
InChI:InChI=1S/C8H11ClN2O2/c1-5(2)4-13-6-3-10-11-8(12)7(6)9/h3,5H,4H2,1-2H3,(H,11,12)
InChI key:InChIKey=VUVINHNAUJHLSE-UHFFFAOYSA-N
SMILES:O(CC(C)C)C1=C(Cl)C(=O)NN=C1
Synonyms:
  • 4-Chloro-5-(2-methylpropoxy)-3(2H)-pyridazinone
  • 3(2H)-Pyridazinone, 4-chloro-5-(2-methylpropoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.