CymitQuimica logo

CAS 1346697-48-0

:

4-Chloro-5-(1,1-dimethylethoxy)-3(2H)-pyridazinone

Description:
4-Chloro-5-(1,1-dimethylethoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core, which features a chlorine substituent and a bulky 1,1-dimethylethoxy group. This structure contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of the chlorine atom typically enhances the compound's electrophilicity, making it useful in various synthetic applications. The 1,1-dimethylethoxy group provides steric hindrance, which can influence the compound's interactions with other molecules, potentially affecting its biological activity and stability. This compound may be of interest in pharmaceutical research and development due to its structural features, which could lead to specific biological activities. Additionally, its molecular weight and functional groups suggest that it may exhibit moderate to high lipophilicity, impacting its absorption and distribution in biological systems. As with many chemical substances, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks.
Formula:C8H11ClN2O2
InChI:InChI=1S/C8H11ClN2O2/c1-8(2,3)13-5-4-10-11-7(12)6(5)9/h4H,1-3H3,(H,11,12)
InChI key:InChIKey=BVQGLOUSTOOEBT-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C1=C(Cl)C(=O)NN=C1
Synonyms:
  • 4-Chloro-5-(1,1-dimethylethoxy)-3(2H)-pyridazinone
  • 3(2H)-Pyridazinone, 4-chloro-5-(1,1-dimethylethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.