CAS 1346697-49-1
:4-Chloro-5-(3-methylbutoxy)-3(2H)-pyridazinone
Description:
4-Chloro-5-(3-methylbutoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core structure, which features a chlorine substituent and a branched alkoxy group. The presence of the chloro group typically imparts certain reactivity, making it a potential candidate for further chemical modifications or applications in synthesis. The 3-methylbutoxy group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in various environments. Additionally, the pyridazinone moiety is known for its stability and can be involved in various chemical reactions, including nucleophilic substitutions. Overall, 4-Chloro-5-(3-methylbutoxy)-3(2H)-pyridazinone presents a unique combination of functional groups that may be explored for diverse applications in pharmaceuticals or agrochemicals.
Formula:C9H13ClN2O2
InChI:InChI=1S/C9H13ClN2O2/c1-6(2)3-4-14-7-5-11-12-9(13)8(7)10/h5-6H,3-4H2,1-2H3,(H,12,13)
InChI key:InChIKey=IVHXMRVDKONTLC-UHFFFAOYSA-N
SMILES:O(CCC(C)C)C1=C(Cl)C(=O)NN=C1
Synonyms:- 4-Chloro-5-(3-methylbutoxy)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 4-chloro-5-(3-methylbutoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
