CAS 1346697-50-4
:4-Chloro-5-(2-methylbutoxy)-3(2H)-pyridazinone
Description:
4-Chloro-5-(2-methylbutoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core structure, which features a chloro substituent and a 2-methylbutoxy group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its functional groups. The presence of the chloro group may influence its reactivity and solubility in various solvents, while the alkoxy group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. As a pyridazinone derivative, it may also exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups. Further studies would be necessary to elucidate its full range of properties and potential applications in research or industry.
Formula:C9H13ClN2O2
InChI:InChI=1S/C9H13ClN2O2/c1-3-6(2)5-14-7-4-11-12-9(13)8(7)10/h4,6H,3,5H2,1-2H3,(H,12,13)
InChI key:InChIKey=YPJKITGOTYXLBJ-UHFFFAOYSA-N
SMILES:O(CC(CC)C)C1=C(Cl)C(=O)NN=C1
Synonyms:- 4-Chloro-5-(2-methylbutoxy)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 4-chloro-5-(2-methylbutoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
