CAS 1346697-54-8
:4-Chloro-5-(cyclopropyloxy)-3(2H)-pyridazinone
Description:
4-Chloro-5-(cyclopropyloxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core, which features a chlorine substituent at the 4-position and a cyclopropyloxy group at the 5-position. This structure contributes to its unique chemical properties, including potential biological activity. The presence of the chlorinated aromatic system may enhance lipophilicity, influencing its solubility and permeability in biological systems. The cyclopropyloxy group can introduce strain and unique steric effects, potentially affecting the compound's reactivity and interaction with biological targets. As a pyridazinone derivative, it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular weight, melting point, and specific reactivity would depend on its detailed structural characteristics and functional groups. Safety and handling considerations should be observed, as with any chemical substance, particularly those with halogen substituents, which may pose environmental and health risks. Overall, 4-Chloro-5-(cyclopropyloxy)-3(2H)-pyridazinone represents a class of compounds that could be explored for various applications in research and industry.
Formula:C7H7ClN2O2
InChI:InChI=1S/C7H7ClN2O2/c8-6-5(12-4-1-2-4)3-9-10-7(6)11/h3-4H,1-2H2,(H,10,11)
InChI key:InChIKey=JYBARJDVVDIOKA-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C(=O)NN=C1)C2CC2
Synonyms:- 3(2H)-Pyridazinone, 4-chloro-5-(cyclopropyloxy)-
- 4-Chloro-5-(cyclopropyloxy)-3(2H)-pyridazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
