CAS 1346697-57-1
:4-Chloro-5-(cyclohexyloxy)-3(2H)-pyridazinone
Description:
4-Chloro-5-(cyclohexyloxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core structure, which features a chloro substituent at the 4-position and a cyclohexyloxy group at the 5-position. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its unique functional groups. The presence of the chloro group can influence its reactivity and solubility, while the cyclohexyloxy moiety may enhance lipophilicity, potentially affecting its pharmacokinetic properties. The compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C10H13ClN2O2
InChI:InChI=1S/C10H13ClN2O2/c11-9-8(6-12-13-10(9)14)15-7-4-2-1-3-5-7/h6-7H,1-5H2,(H,13,14)
InChI key:InChIKey=GLZDFIIHPOGQPG-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C(=O)NN=C1)C2CCCCC2
Synonyms:- 4-Chloro-5-(cyclohexyloxy)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 4-chloro-5-(cyclohexyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
