CAS 1346697-61-7
:4-Chloro-5-(phenylmethoxy)-3(2H)-pyridazinone
Description:
4-Chloro-5-(phenylmethoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core, which features a chloro substituent at the 4-position and a phenylmethoxy group at the 5-position. This structure contributes to its potential biological activity and makes it of interest in medicinal chemistry. The presence of the chloro group can enhance lipophilicity and influence the compound's reactivity, while the phenylmethoxy moiety may provide steric bulk and electronic effects that can modulate interactions with biological targets. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods. As with many pyridazinone derivatives, it may possess pharmacological properties, making it a candidate for further research in drug development. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks.
Formula:C11H9ClN2O2
InChI:InChI=1S/C11H9ClN2O2/c12-10-9(6-13-14-11(10)15)16-7-8-4-2-1-3-5-8/h1-6H,7H2,(H,14,15)
InChI key:InChIKey=BTFBGGIHXHXQNS-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(Cl)C(=O)NN=C2
Synonyms:- 4-Chloro-5-(phenylmethoxy)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 4-chloro-5-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
