
CAS 1346697-62-8
:4-Chloro-5-(2,2,2-trifluoroethoxy)-3(2H)-pyridazinone
Description:
4-Chloro-5-(2,2,2-trifluoroethoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core structure, which features a chloro substituent and a trifluoroethoxy group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the pyridazinone moiety. The chloro group can influence its reactivity and solubility, while the trifluoroethoxy group may enhance lipophilicity and stability. The presence of fluorine atoms often imparts unique electronic properties, which can affect the compound's interaction with biological targets. This substance may be of interest in pharmaceutical research and development, particularly in the context of designing new therapeutic agents. Its specific applications and behavior would depend on further studies, including its synthesis, stability under various conditions, and biological activity. As with any chemical, safety data and handling precautions should be considered when working with this compound.
Formula:C6H4ClF3N2O2
InChI:InChI=1S/C6H4ClF3N2O2/c7-4-3(1-11-12-5(4)13)14-2-6(8,9)10/h1H,2H2,(H,12,13)
InChI key:InChIKey=UMTGSGIYXGREFF-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)C1=C(Cl)C(=O)NN=C1
Synonyms:- 4-Chloro-5-(2,2,2-trifluoroethoxy)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 4-chloro-5-(2,2,2-trifluoroethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.