CAS 1346697-64-0
:4-Chloro-5-(2-methoxyethoxy)-3(2H)-pyridazinone
Description:
4-Chloro-5-(2-methoxyethoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core structure, which features a chloro substituent at the 4-position and a methoxyethoxy group at the 5-position. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its functional groups. The presence of the chloro group can influence its reactivity and solubility, while the methoxyethoxy moiety may enhance its lipophilicity and ability to interact with biological membranes. The compound is likely to be a solid at room temperature, with moderate stability under standard conditions. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where pyridazinone derivatives are often explored for their therapeutic properties. As with many organic compounds, safety data should be consulted for handling and usage, as the presence of chlorine may pose specific hazards. Overall, 4-Chloro-5-(2-methoxyethoxy)-3(2H)-pyridazinone represents a unique structure with potential utility in various chemical and biological contexts.
Formula:C7H9ClN2O3
InChI:InChI=1S/C7H9ClN2O3/c1-12-2-3-13-5-4-9-10-7(11)6(5)8/h4H,2-3H2,1H3,(H,10,11)
InChI key:InChIKey=BEDGOTBJVXBHSE-UHFFFAOYSA-N
SMILES:O(CCOC)C1=C(Cl)C(=O)NN=C1
Synonyms:- 4-Chloro-5-(2-methoxyethoxy)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 4-chloro-5-(2-methoxyethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
