CymitQuimica logo

CAS 1346697-68-4

:

Ethyl 3-[(5-chloro-1,6-dihydro-6-oxo-4-pyridazinyl)oxy]propanoate

Description:
Ethyl 3-[(5-chloro-1,6-dihydro-6-oxo-4-pyridazinyl)oxy]propanoate is a chemical compound characterized by its unique structure, which includes an ethyl ester functional group and a pyridazine moiety. The presence of the chloro substituent on the pyridazine ring contributes to its reactivity and potential biological activity. This compound is typically a solid or liquid at room temperature, depending on its specific formulation and purity. It is soluble in organic solvents, which is common for esters and heterocyclic compounds. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its synthesis often involves the reaction of ethyl propanoate with a pyridazine derivative, highlighting its potential applications in drug development. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the presence of chlorine and the heterocyclic structure may pose specific hazards. Overall, this compound represents a class of chemicals that could be explored for therapeutic uses or as intermediates in organic synthesis.
Formula:C9H11ClN2O4
InChI:InChI=1S/C9H11ClN2O4/c1-2-15-7(13)3-4-16-6-5-11-12-9(14)8(6)10/h5H,2-4H2,1H3,(H,12,14)
InChI key:InChIKey=QJODMUSTVCEZAS-UHFFFAOYSA-N
SMILES:O(CCC(OCC)=O)C1=C(Cl)C(=O)NN=C1
Synonyms:
  • Ethyl 3-[(5-chloro-1,6-dihydro-6-oxo-4-pyridazinyl)oxy]propanoate
  • Propanoic acid, 3-[(5-chloro-1,6-dihydro-6-oxo-4-pyridazinyl)oxy]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.