CymitQuimica logo

CAS 1346697-70-8

:

4-Chloro-5-(2-fluoroethoxy)-3(2H)-pyridazinone

Description:
4-Chloro-5-(2-fluoroethoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core structure, which features a chloro substituent at the 4-position and a fluoroethoxy group at the 5-position. This compound is typically classified as a heterocyclic organic molecule, containing both nitrogen and oxygen in its ring structure. The presence of the chloro and fluoro substituents suggests potential reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. The molecular structure contributes to its physical properties, such as solubility and stability, which can vary based on the specific functional groups attached. Additionally, the compound may exhibit specific interactions with biological targets, influencing its efficacy in medicinal applications. Its CAS number, 1346697-70-8, serves as a unique identifier for regulatory and safety information. Overall, the characteristics of this compound highlight its potential utility in various chemical and biological contexts.
Formula:C6H6ClFN2O2
InChI:InChI=1S/C6H6ClFN2O2/c7-5-4(12-2-1-8)3-9-10-6(5)11/h3H,1-2H2,(H,10,11)
InChI key:InChIKey=DYCMKEZWTPRYFK-UHFFFAOYSA-N
SMILES:O(CCF)C1=C(Cl)C(=O)NN=C1
Synonyms:
  • 4-Chloro-5-(2-fluoroethoxy)-3(2H)-pyridazinone
  • 3(2H)-Pyridazinone, 4-chloro-5-(2-fluoroethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.