CymitQuimica logo

CAS 1346697-72-0

:

5-(1-Methylethoxy)-3(2H)-pyridazinone

Description:
5-(1-Methylethoxy)-3(2H)-pyridazinone, identified by its CAS number 1346697-72-0, is a chemical compound that belongs to the pyridazinone class, which is characterized by a pyridazine ring fused with a ketone. This compound features a methylethoxy group, which contributes to its unique chemical properties and potential applications. Pyridazinones are often studied for their biological activities, including anti-inflammatory and antimicrobial properties. The presence of the methylethoxy substituent may influence the compound's solubility, stability, and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, the molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral data would be essential for practical applications and further research. Overall, 5-(1-Methylethoxy)-3(2H)-pyridazinone represents a compound with potential utility in various chemical and biological contexts.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-5(2)11-6-3-7(10)9-8-4-6/h3-5H,1-2H3,(H,9,10)
InChI key:InChIKey=DUVWFDIDHQGROK-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=CC(=O)NN=C1
Synonyms:
  • 3(2H)-Pyridazinone, 5-(1-methylethoxy)-
  • 5-(1-Methylethoxy)-3(2H)-pyridazinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.