
CAS 1346697-75-3
:5-(1,1-Dimethylethoxy)-3(2H)-pyridazinone
Description:
5-(1,1-Dimethylethoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core, which is a bicyclic structure containing a pyridine ring fused to a 1,2-diazole. This compound features a 1,1-dimethylethoxy group, which contributes to its unique properties, including increased lipophilicity and potential biological activity. The presence of the dimethylethoxy substituent can influence the compound's solubility, stability, and reactivity. Pyridazinones are often studied for their pharmacological properties, including anti-inflammatory and analgesic effects. The specific structure of this compound may also suggest potential applications in medicinal chemistry or agrochemicals. As with many organic compounds, its behavior in various environments, such as in solvents or biological systems, can be influenced by factors like pH, temperature, and the presence of other chemical species. Understanding these characteristics is crucial for its application in research and industry.
Formula:C8H12N2O2
InChI:InChI=1S/C8H12N2O2/c1-8(2,3)12-6-4-7(11)10-9-5-6/h4-5H,1-3H3,(H,10,11)
InChI key:InChIKey=UPMSJTDZPJNBLS-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C1=CC(=O)NN=C1
Synonyms:- 3(2H)-Pyridazinone, 5-(1,1-dimethylethoxy)-
- 5-(1,1-Dimethylethoxy)-3(2H)-pyridazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
