CAS 1346697-76-4

5-(3-Methylbutoxy)-3(2H)-pyridazinone

Description:

5-(3-Methylbutoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core, which features a pyridazine ring with a ketone functional group. The presence of the 3-methylbutoxy group indicates that it has an ether functional group, contributing to its solubility and reactivity. This compound may exhibit properties typical of pyridazinones, such as potential biological activity, including anti-inflammatory or analgesic effects, depending on its specific structure and substituents. The molecular structure suggests it may participate in hydrogen bonding due to the presence of the ketone and ether functionalities, influencing its physical properties like boiling and melting points. Additionally, the compound's molecular weight, polarity, and steric hindrance from the branched alkyl group can affect its interactions in biological systems and its overall stability. As with many organic compounds, its reactivity can be influenced by environmental factors such as pH and temperature, making it of interest in various chemical and pharmaceutical applications.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1S/C9H14N2O2/c1-7(2)3-4-13-8-5-9(12)11-10-6-8/h5-7H,3-4H2,1-2H3,(H,11,12)

InChI key: InChIKey=METKAQPDOLOUGP-UHFFFAOYSA-N

SMILES: O(CCC(C)C)C1=CC(=O)NN=C1

Synonyms:

• 5-(3-Methylbutoxy)-3(2H)-pyridazinone
• 3(2H)-Pyridazinone, 5-(3-methylbutoxy)-