CymitQuimica logo

CAS 1346697-80-0

:

5-(1-Ethylpropoxy)-3(2H)-pyridazinone

Description:
5-(1-Ethylpropoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core, which is a bicyclic structure containing a pyridazine ring fused with a carbonyl group. This compound features an ethylpropoxy substituent, which contributes to its unique properties and potential applications. Generally, pyridazinones are known for their biological activity, often exhibiting pharmacological properties such as anti-inflammatory, analgesic, or antimicrobial effects. The presence of the ethylpropoxy group may enhance lipophilicity, influencing the compound's solubility and permeability, which are critical factors in drug design. Additionally, the molecular structure suggests potential for hydrogen bonding and interactions with biological targets. As with many organic compounds, the stability, reactivity, and specific applications of 5-(1-Ethylpropoxy)-3(2H)-pyridazinone would depend on its synthesis, purity, and the conditions under which it is used. Further research would be necessary to fully elucidate its characteristics and potential uses in various fields, including medicinal chemistry and agrochemicals.
Formula:C9H14N2O2
InChI:InChI=1S/C9H14N2O2/c1-3-7(4-2)13-8-5-9(12)11-10-6-8/h5-7H,3-4H2,1-2H3,(H,11,12)
InChI key:InChIKey=OIEIJWNPAVSECT-UHFFFAOYSA-N
SMILES:O(C(CC)CC)C1=CC(=O)NN=C1
Synonyms:
  • 3(2H)-Pyridazinone, 5-(1-ethylpropoxy)-
  • 5-(1-Ethylpropoxy)-3(2H)-pyridazinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.