
CAS 1346697-81-1
:5-(Cyclopropyloxy)-3(2H)-pyridazinone
Description:
5-(Cyclopropyloxy)-3(2H)-pyridazinone is a chemical compound characterized by its unique structure, which includes a pyridazinone core substituted with a cyclopropyloxy group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the pyridazinone moiety, which is known for its role in various pharmacological applications. The cyclopropyloxy group can influence the compound's solubility, stability, and reactivity, making it of interest in medicinal chemistry. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which can affect its behavior in biological systems. Additionally, the compound's specific characteristics, such as melting point, boiling point, and spectral properties, would be determined through experimental methods. Overall, 5-(Cyclopropyloxy)-3(2H)-pyridazinone represents a class of compounds that may have potential applications in drug development and other fields of chemistry.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c10-7-3-6(4-8-9-7)11-5-1-2-5/h3-5H,1-2H2,(H,9,10)
InChI key:InChIKey=YDLQAYPFRUNZOM-UHFFFAOYSA-N
SMILES:O(C1CC1)C2=CC(=O)NN=C2
Synonyms:- 3(2H)-Pyridazinone, 5-(cyclopropyloxy)-
- 5-(Cyclopropyloxy)-3(2H)-pyridazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
