CAS 1346697-86-6
:5-(Cyclobutylmethoxy)-3(2H)-pyridazinone
Description:
5-(Cyclobutylmethoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core, which features a pyridazine ring fused with a carbonyl group and a methoxy group attached to a cyclobutyl moiety. This structure contributes to its potential biological activity and solubility properties. The presence of the cyclobutyl group may influence its steric and electronic properties, potentially affecting its interactions with biological targets. The compound is likely to exhibit moderate to high lipophilicity due to the cyclobutyl substituent, which can enhance membrane permeability. Additionally, the methoxy group can participate in hydrogen bonding, influencing its reactivity and solubility in various solvents. As a pyridazinone derivative, it may possess pharmacological properties, making it of interest in medicinal chemistry. However, specific data regarding its toxicity, stability, and detailed biological activity would require further investigation through experimental studies. Overall, this compound represents a unique structure that may have applications in drug development and other chemical research fields.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c12-9-4-8(5-10-11-9)13-6-7-2-1-3-7/h4-5,7H,1-3,6H2,(H,11,12)
InChI key:InChIKey=YOAYXADILZTHQN-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C2=CC(=O)NN=C2
Synonyms:- 5-(Cyclobutylmethoxy)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 5-(cyclobutylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
