CAS 1346697-87-7
:5-(Cyclohexylmethoxy)-3(2H)-pyridazinone
Description:
5-(Cyclohexylmethoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core, which features a pyridazine ring with a ketone and an ether functional group. The presence of the cyclohexylmethoxy group contributes to its hydrophobic properties, potentially influencing its solubility and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential for hydrogen bonding and steric interactions due to the bulky cyclohexyl group. The compound's stability, reactivity, and potential applications can be influenced by the specific arrangement of its functional groups. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally. Additionally, safety and handling considerations are essential, as with any chemical substance, to ensure proper usage in laboratory or industrial settings.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c14-11-6-10(7-12-13-11)15-8-9-4-2-1-3-5-9/h6-7,9H,1-5,8H2,(H,13,14)
InChI key:InChIKey=YLBVIXXRRRCODB-UHFFFAOYSA-N
SMILES:O(CC1CCCCC1)C2=CC(=O)NN=C2
Synonyms:- 3(2H)-Pyridazinone, 5-(cyclohexylmethoxy)-
- 5-(Cyclohexylmethoxy)-3(2H)-pyridazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
