CAS 1346697-89-9
:5-(3,3,3-Trifluoropropoxy)-3(2H)-pyridazinone
Description:
5-(3,3,3-Trifluoropropoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core, which is a bicyclic structure containing a pyridine ring fused to a hydrazine-derived moiety. The presence of the trifluoropropoxy group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. This compound typically exhibits moderate to high stability under standard conditions, although specific stability can depend on environmental factors such as pH and temperature. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the trifluoromethyl group is known to impart unique electronic properties, potentially affecting the compound's reactivity and solubility. As with many fluorinated compounds, it may exhibit distinct pharmacokinetic profiles, including absorption, distribution, metabolism, and excretion characteristics. Safety and handling precautions should be observed due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C7H7F3N2O2
InChI:InChI=1S/C7H7F3N2O2/c8-7(9,10)1-2-14-5-3-6(13)12-11-4-5/h3-4H,1-2H2,(H,12,13)
InChI key:InChIKey=LVVKFCZVZKXDIW-UHFFFAOYSA-N
SMILES:O(CCC(F)(F)F)C1=CC(=O)NN=C1
Synonyms:- 5-(3,3,3-Trifluoropropoxy)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 5-(3,3,3-trifluoropropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
