CAS 1346697-91-3
:Methyl 2-[(1,6-dihydro-6-oxo-4-pyridazinyl)oxy]acetate
Description:
Methyl 2-[(1,6-dihydro-6-oxo-4-pyridazinyl)oxy]acetate, identified by its CAS number 1346697-91-3, is a chemical compound characterized by its unique structure that includes a pyridazine ring. This compound features an ester functional group, which contributes to its reactivity and solubility properties. The presence of the pyridazinyl moiety suggests potential biological activity, as many pyridazine derivatives are known for their pharmacological properties. Typically, such compounds may exhibit characteristics such as moderate polarity, which can influence their solubility in various solvents, and they may participate in hydrogen bonding due to the presence of oxygen atoms. The compound's molecular structure may also suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical properties such as boiling point, melting point, and spectral data would require empirical measurement or literature reference for precise characterization. Overall, Methyl 2-[(1,6-dihydro-6-oxo-4-pyridazinyl)oxy]acetate represents a class of compounds with potential utility in various chemical and pharmaceutical applications.
Formula:C7H8N2O4
InChI:InChI=1S/C7H8N2O4/c1-12-7(11)4-13-5-2-6(10)9-8-3-5/h2-3H,4H2,1H3,(H,9,10)
InChI key:InChIKey=GQRNTTJIWBMFGZ-UHFFFAOYSA-N
SMILES:O(CC(OC)=O)C1=CC(=O)NN=C1
Synonyms:- Methyl 2-[(1,6-dihydro-6-oxo-4-pyridazinyl)oxy]acetate
- Acetic acid, 2-[(1,6-dihydro-6-oxo-4-pyridazinyl)oxy]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
