
CAS 1346697-93-5
:Methyl 3-[(1,6-dihydro-6-oxo-4-pyridazinyl)oxy]propanoate
Description:
Methyl 3-[(1,6-dihydro-6-oxo-4-pyridazinyl)oxy]propanoate is a chemical compound characterized by its unique structure, which includes a pyridazine ring and an ester functional group. The presence of the pyridazine moiety contributes to its potential biological activity, as pyridazines are often associated with various pharmacological properties. This compound is typically a white to off-white solid or a viscous liquid, depending on its purity and specific conditions. It is soluble in organic solvents, which is common for esters, but may have limited solubility in water. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Its applications could span across medicinal chemistry, agrochemicals, or materials science, depending on its specific properties and reactivity.
Formula:C8H10N2O4
InChI:InChI=1S/C8H10N2O4/c1-13-8(12)2-3-14-6-4-7(11)10-9-5-6/h4-5H,2-3H2,1H3,(H,10,11)
InChI key:InChIKey=MCHRXAIAWWVNTP-UHFFFAOYSA-N
SMILES:O(CCC(OC)=O)C1=CC(=O)NN=C1
Synonyms:- Methyl 3-[(1,6-dihydro-6-oxo-4-pyridazinyl)oxy]propanoate
- Propanoic acid, 3-[(1,6-dihydro-6-oxo-4-pyridazinyl)oxy]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 3-((6-oxo-1,6-dihydropyridazin-4-yl)oxy)propanoate
CAS:Formula:C8H10N2O4Molecular weight:198.1760
