
CAS 1346697-95-7
:5-(2-Fluoroethoxy)-3(2H)-pyridazinone
Description:
5-(2-Fluoroethoxy)-3(2H)-pyridazinone is a chemical compound characterized by its pyridazinone core, which features a pyridazine ring fused with a carbonyl group and an ether substituent. The presence of the 2-fluoroethoxy group indicates that the compound has a fluorinated ethyl ether moiety, which can influence its reactivity and solubility. This compound may exhibit properties typical of pyridazinones, such as potential biological activity, making it of interest in pharmaceutical research. The fluorine atom can enhance lipophilicity and metabolic stability, potentially affecting the compound's pharmacokinetics. Additionally, the structure suggests that it may participate in hydrogen bonding due to the carbonyl and ether functionalities, which could influence its interactions with biological targets. Overall, 5-(2-Fluoroethoxy)-3(2H)-pyridazinone is a synthetic organic compound that may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C6H7FN2O2
InChI:InChI=1S/C6H7FN2O2/c7-1-2-11-5-3-6(10)9-8-4-5/h3-4H,1-2H2,(H,9,10)
InChI key:InChIKey=WSWWDRYLJXTOEQ-UHFFFAOYSA-N
SMILES:O(CCF)C1=CC(=O)NN=C1
Synonyms:- 5-(2-Fluoroethoxy)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 5-(2-fluoroethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
