CAS 1346697-99-1
:3,4-Dichloro-5-(1-methylethoxy)pyridazine
Description:
3,4-Dichloro-5-(1-methylethoxy)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of two chlorine atoms at the 3 and 4 positions contributes to its reactivity and potential applications in various chemical processes. The substituent 1-methylethoxy at the 5 position enhances its solubility and may influence its biological activity. This compound is typically used in research and development, particularly in the fields of agrochemicals and pharmaceuticals, due to its potential as a building block for more complex molecules. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can exhibit varying degrees of environmental persistence and biological effects. Overall, 3,4-Dichloro-5-(1-methylethoxy)pyridazine represents a versatile structure in synthetic organic chemistry.
Formula:C7H8Cl2N2O
InChI:InChI=1S/C7H8Cl2N2O/c1-4(2)12-5-3-10-11-7(9)6(5)8/h3-4H,1-2H3
InChI key:InChIKey=FDCQGBBYHOVMPD-UHFFFAOYSA-N
SMILES:O(C(C)C)C=1C(Cl)=C(Cl)N=NC1
Synonyms:- 3,4-Dichloro-5-(1-methylethoxy)pyridazine
- Pyridazine, 3,4-dichloro-5-(1-methylethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
