CAS 1346698-00-7
:5-Butoxy-3,4-dichloropyridazine
Description:
5-Butoxy-3,4-dichloropyridazine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of two chlorine atoms at the 3 and 4 positions of the ring contributes to its reactivity and potential biological activity. The butoxy group, attached at the 5 position, enhances its solubility in organic solvents and may influence its interaction with biological systems. This compound is likely to exhibit properties typical of halogenated organic compounds, such as increased lipophilicity and potential for environmental persistence. Its structure suggests potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and safety profile. As with many halogenated compounds, considerations regarding toxicity and environmental impact are essential in its handling and application. Overall, 5-Butoxy-3,4-dichloropyridazine represents a class of compounds that may have significant implications in various fields of chemistry and material science.
Formula:C8H10Cl2N2O
InChI:InChI=1S/C8H10Cl2N2O/c1-2-3-4-13-6-5-11-12-8(10)7(6)9/h5H,2-4H2,1H3
InChI key:InChIKey=FPWAUXPVWSYAED-UHFFFAOYSA-N
SMILES:O(CCCC)C=1C(Cl)=C(Cl)N=NC1
Synonyms:- 5-Butoxy-3,4-dichloropyridazine
- Pyridazine, 5-butoxy-3,4-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
